C19H20N2O2 — CID 102349438
(1R)-1-[5-[(S)-methoxy(phenyl)methyl]-1H-imidazol-2-yl]-2-phenylethanol (PubChem CID 102349438) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (1R)-1-[5-[(S)-methoxy(phenyl)methyl]-1H-imidazol-2-yl]-2-phenylethanol.
| Compound Name | (1R)-1-[5-[(S)-methoxy(phenyl)methyl]-1H-imidazol-2-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 102349438 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (1R)-1-[5-[(S)-methoxy(phenyl)methyl]-1H-imidazol-2-yl]-2-phenylethanol |
| SMILES | CO[C@@H](c1ccccc1)c1cnc([C@H](O)Cc2ccccc2)[nH]1 |
| InChI | InChI=1S/C19H20N2O2/c1-23-18(15-10-6-3-7-11-15)16-13-20-19(21-16)17(22)12-14-8-4-2-5-9-14/h2-11,13,17-18,22H,12H2,1H3,(H,20,21)/t17-,18+/m1/s1 |
| InChIKey | DDNFQVRRFSHZCB-MSOLQXFVSA-N |
| XLogP | 3.42 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |