C18H19FN2O4 — CID 164521183
4-[[2-[2-deuterio-6-fluoro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-hydroxyphenyl]acetyl]amino]pyridine-2-carboxylic acid (PubChem CID 164521183) has the molecular formula C18H19FN2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[[2-[2-deuterio-6-fluoro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-hydroxyphenyl]acetyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 4-[[2-[2-deuterio-6-fluoro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-hydroxyphenyl]acetyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 164521183 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 4-[[2-[2-deuterio-6-fluoro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-hydroxyphenyl]acetyl]amino]pyridine-2-carboxylic acid |
| SMILES | [2H]c1c(O)c(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])cc(F)c1CC(=O)Nc1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C18H19FN2O4/c1-18(2,3)12-9-13(19)10(6-15(12)22)7-16(23)21-11-4-5-20-14(8-11)17(24)25/h4-6,8-9,22H,7H2,1-3H3,(H,24,25)(H,20,21,23)/i1D3,2D3,3D3,6D |
| InChIKey | BJAXKHSLHLXFGZ-IZQNBIEASA-N |
| XLogP | 3.10 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |