C20H22FNO4 — CID 167572616
4-[3-[2-deuterio-6-fluoro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-methoxyphenyl]-2-oxopropyl]pyridine-2-carboxylic acid (PubChem CID 167572616) has the molecular formula C20H22FNO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-[3-[2-deuterio-6-fluoro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-methoxyphenyl]-2-oxopropyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[3-[2-deuterio-6-fluoro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-methoxyphenyl]-2-oxopropyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 167572616 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 4-[3-[2-deuterio-6-fluoro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-methoxyphenyl]-2-oxopropyl]pyridine-2-carboxylic acid |
| SMILES | [2H]c1c(CC(=O)Cc2ccnc(C(=O)O)c2)c(F)cc(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c1OC |
| InChI | InChI=1S/C20H22FNO4/c1-20(2,3)15-11-16(21)13(10-18(15)26-4)9-14(23)7-12-5-6-22-17(8-12)19(24)25/h5-6,8,10-11H,7,9H2,1-4H3,(H,24,25)/i1D3,2D3,3D3,10D |
| InChIKey | GCKDDHNEMQCHAQ-CGDOGRBOSA-N |
| XLogP | 3.58 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |