C16H18ClN3O2 — CID 164521519
benzyl (1R,5S,6Z)-6-(cyanomethylidene)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate;hydrochloride (PubChem CID 164521519) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is benzyl (1R,5S,6Z)-6-(cyanomethylidene)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate;hydrochloride.
| Compound Name | benzyl (1R,5S,6Z)-6-(cyanomethylidene)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 164521519 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | benzyl (1R,5S,6Z)-6-(cyanomethylidene)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate;hydrochloride |
| SMILES | Cl.N#C/C=C1/C[C@@H]2CNC[C@H]1N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H17N3O2.ClH/c17-7-6-13-8-14-9-18-10-15(13)19(14)16(20)21-11-12-4-2-1-3-5-12;/h1-6,14-15,18H,8-11H2;1H/b13-6-;/t14-,15-;/m1./s1 |
| InChIKey | WQCFTDQACQGJLB-KNFUKRPWSA-N |
| XLogP | 2.24 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|