C14H14N2O2 — CID 130355848
benzyl (2R,3E)-3-(cyanomethylidene)-2-methylazetidine-1-carboxylate (PubChem CID 130355848) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is benzyl (2R,3E)-3-(cyanomethylidene)-2-methylazetidine-1-carboxylate.
| Compound Name | benzyl (2R,3E)-3-(cyanomethylidene)-2-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 130355848 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | benzyl (2R,3E)-3-(cyanomethylidene)-2-methylazetidine-1-carboxylate |
| SMILES | C[C@@H]1/C(=C/C#N)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H14N2O2/c1-11-13(7-8-15)9-16(11)14(17)18-10-12-5-3-2-4-6-12/h2-7,11H,9-10H2,1H3/b13-7+/t11-/m1/s1 |
| InChIKey | ZZHODBLDHXBIHF-ZTFCMROMSA-N |
| XLogP | 2.48 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|