C26H38F2O3S2 — CID 164525126
S-[4,4-difluoro-7-(2-oxochromen-4-yl)sulfanylheptyl] methanethioate;2,2,5-trimethylhexane (PubChem CID 164525126) has the molecular formula C26H38F2O3S2 and a molecular weight of 500.72 g/mol. Its IUPAC name is S-[4,4-difluoro-7-(2-oxochromen-4-yl)sulfanylheptyl] methanethioate;2,2,5-trimethylhexane.
| Compound Name | S-[4,4-difluoro-7-(2-oxochromen-4-yl)sulfanylheptyl] methanethioate;2,2,5-trimethylhexane |
|---|---|
| PubChem CID | 164525126 |
| Molecular Formula | C26H38F2O3S2 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | S-[4,4-difluoro-7-(2-oxochromen-4-yl)sulfanylheptyl] methanethioate;2,2,5-trimethylhexane |
| SMILES | CC(C)CCC(C)(C)C.O=CSCCCC(F)(F)CCCSc1cc(=O)oc2ccccc12 |
| InChI | InChI=1S/C17H18F2O3S2.C9H20/c18-17(19,7-3-9-23-12-20)8-4-10-24-15-11-16(21)22-14-6-2-1-5-13(14)15;1-8(2)6-7-9(3,4)5/h1-2,5-6,11-12H,3-4,7-10H2;8H,6-7H2,1-5H3 |
| InChIKey | SCICMRJKPIESKC-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|