C25H34O4S2 — CID 164525477
6-(7-cyclohexylsulfanyl-2-oxochromen-4-yl)sulfanylhexyl 2-methylpropanoate (PubChem CID 164525477) has the molecular formula C25H34O4S2 and a molecular weight of 462.68 g/mol. Its IUPAC name is 6-(7-cyclohexylsulfanyl-2-oxochromen-4-yl)sulfanylhexyl 2-methylpropanoate.
| Compound Name | 6-(7-cyclohexylsulfanyl-2-oxochromen-4-yl)sulfanylhexyl 2-methylpropanoate |
|---|---|
| PubChem CID | 164525477 |
| Molecular Formula | C25H34O4S2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 6-(7-cyclohexylsulfanyl-2-oxochromen-4-yl)sulfanylhexyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCCCSc1cc(=O)oc2cc(SC3CCCCC3)ccc12 |
| InChI | InChI=1S/C25H34O4S2/c1-18(2)25(27)28-14-8-3-4-9-15-30-23-17-24(26)29-22-16-20(12-13-21(22)23)31-19-10-6-5-7-11-19/h12-13,16-19H,3-11,14-15H2,1-2H3 |
| InChIKey | ZRLJXZDOZWPWBT-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|