C16H23FN4O3 — CID 164527147
methyl 3-[[3-[(Z)-2-amino-1-[amino(propyl)amino]ethenyl]-5-fluorobenzoyl]amino]propanoate (PubChem CID 164527147) has the molecular formula C16H23FN4O3 and a molecular weight of 338.38 g/mol. Its IUPAC name is methyl 3-[[3-[(Z)-2-amino-1-[amino(propyl)amino]ethenyl]-5-fluorobenzoyl]amino]propanoate.
| Compound Name | methyl 3-[[3-[(Z)-2-amino-1-[amino(propyl)amino]ethenyl]-5-fluorobenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 164527147 |
| Molecular Formula | C16H23FN4O3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | methyl 3-[[3-[(Z)-2-amino-1-[amino(propyl)amino]ethenyl]-5-fluorobenzoyl]amino]propanoate |
| SMILES | CCCN(N)/C(=C\N)c1cc(F)cc(C(=O)NCCC(=O)OC)c1 |
| InChI | InChI=1S/C16H23FN4O3/c1-3-6-21(19)14(10-18)11-7-12(9-13(17)8-11)16(23)20-5-4-15(22)24-2/h7-10H,3-6,18-19H2,1-2H3,(H,20,23)/b14-10- |
| InChIKey | UBIAGELKIMMNRE-UVTDQMKNSA-N |
| XLogP | 0.96 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|