C15H18FN3O3 — CID 164527776
3-[[3-[(Z)-2-amino-4-iminopent-2-en-3-yl]-5-fluorobenzoyl]amino]propanoic acid (PubChem CID 164527776) has the molecular formula C15H18FN3O3 and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-[[3-[(Z)-2-amino-4-iminopent-2-en-3-yl]-5-fluorobenzoyl]amino]propanoic acid.
| Compound Name | 3-[[3-[(Z)-2-amino-4-iminopent-2-en-3-yl]-5-fluorobenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 164527776 |
| Molecular Formula | C15H18FN3O3 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-[[3-[(Z)-2-amino-4-iminopent-2-en-3-yl]-5-fluorobenzoyl]amino]propanoic acid |
| SMILES | [H]/N=C(C)/C(=C(/C)N)c1cc(F)cc(C(=O)NCCC(=O)O)c1 |
| InChI | InChI=1S/C15H18FN3O3/c1-8(17)14(9(2)18)10-5-11(7-12(16)6-10)15(22)19-4-3-13(20)21/h5-7,17H,3-4,18H2,1-2H3,(H,19,22)(H,20,21)/b14-9+,17-8+ |
| InChIKey | LWESYWOTNIUCLC-WSWGPGCFSA-N |
| XLogP | 1.76 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|