C18H14ClN — CID 164527932
4-chloro-5-methyl-2,3-diphenylpyridine (PubChem CID 164527932) has the molecular formula C18H14ClN and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-chloro-5-methyl-2,3-diphenylpyridine.
| Compound Name | 4-chloro-5-methyl-2,3-diphenylpyridine |
|---|---|
| PubChem CID | 164527932 |
| Molecular Formula | C18H14ClN |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-chloro-5-methyl-2,3-diphenylpyridine |
| SMILES | Cc1cnc(-c2ccccc2)c(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C18H14ClN/c1-13-12-20-18(15-10-6-3-7-11-15)16(17(13)19)14-8-4-2-5-9-14/h2-12H,1H3 |
| InChIKey | SDIAFDOLMZATPA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |