About 4-chloro-5-methyl-2,3-diphenylpyridine
4-chloro-5-methyl-2,3-diphenylpyridine (PubChem CID 164527932) has the molecular formula C18H14ClN
and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-chloro-5-methyl-2,3-diphenylpyridine.
Molecular Properties
| Compound Name | 4-chloro-5-methyl-2,3-diphenylpyridine |
| PubChem CID | 164527932 |
| Molecular Formula | C18H14ClN |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-chloro-5-methyl-2,3-diphenylpyridine |
| SMILES | Cc1cnc(-c2ccccc2)c(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C18H14ClN/c1-13-12-20-18(15-10-6-3-7-11-15)16(17(13)19)14-8-4-2-5-9-14/h2-12H,1H3 |
| InChIKey | SDIAFDOLMZATPA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-5-methyl-2,3-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-methyl-2,3-diphenylpyridine?
The IUPAC name of 4-chloro-5-methyl-2,3-diphenylpyridine (CID 164527932) is 4-chloro-5-methyl-2,3-diphenylpyridine.
What is the SMILES notation for 4-chloro-5-methyl-2,3-diphenylpyridine?
The canonical SMILES for 4-chloro-5-methyl-2,3-diphenylpyridine is Cc1cnc(-c2ccccc2)c(-c2ccccc2)c1Cl.
What is the InChIKey of 4-chloro-5-methyl-2,3-diphenylpyridine?
The InChIKey is SDIAFDOLMZATPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN/c1-13-12-20-18(15-10-6-3-7-11-15)16(17(13)19)14-8-4-2-5-9-14/h2-12H,1H3.
What are the key properties of 4-chloro-5-methyl-2,3-diphenylpyridine?
4-chloro-5-methyl-2,3-diphenylpyridine has a molecular weight of 279.77 g/mol, XLogP of 5.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-methyl-2,3-diphenylpyridine is sourced from PubChem (CID 164527932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).