C25H33Cl2N5O5 — CID 164530078
tert-butyl 4-[2-[2-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-5-(hydrazinecarbonyl)phenoxy]ethyl]piperidine-1-carboxylate (PubChem CID 164530078) has the molecular formula C25H33Cl2N5O5 and a molecular weight of 554.48 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-5-(hydrazinecarbonyl)phenoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-5-(hydrazinecarbonyl)phenoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164530078 |
| Molecular Formula | C25H33Cl2N5O5 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | tert-butyl 4-[2-[2-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-5-(hydrazinecarbonyl)phenoxy]ethyl]piperidine-1-carboxylate |
| SMILES | Cc1[nH]c(C(=O)Nc2ccc(C(=O)NN)cc2OCCC2CCN(C(=O)OC(C)(C)C)CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C25H33Cl2N5O5/c1-14-19(26)20(27)21(29-14)23(34)30-17-6-5-16(22(33)31-28)13-18(17)36-12-9-15-7-10-32(11-8-15)24(35)37-25(2,3)4/h5-6,13,15,29H,7-12,28H2,1-4H3,(H,30,34)(H,31,33) |
| InChIKey | UDRMKGAXLZQUFR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|