C6H9F2N2+ — CID 164532230
1-(2,2-difluoroethyl)-3-methylimidazol-3-ium (PubChem CID 164532230) has the molecular formula C6H9F2N2+ and a molecular weight of 147.15 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methylimidazol-3-ium.
| Compound Name | 1-(2,2-difluoroethyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 164532230 |
| Molecular Formula | C6H9F2N2+ |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-methylimidazol-3-ium |
| SMILES | C[n+]1ccn(CC(F)F)c1 |
| InChI | InChI=1S/C6H9F2N2/c1-9-2-3-10(5-9)4-6(7)8/h2-3,5-6H,4H2,1H3/q+1 |
| InChIKey | YPXYBTWQTFBQIA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|