C34H36F2N6O3 — CID 164534526
7-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-[(1-methylazocan-5-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]-4,4a,5,6,8,8a-hexahydro-2,7-naphthyridine-1,3-dione (PubChem CID 164534526) has the molecular formula C34H36F2N6O3 and a molecular weight of 614.70 g/mol. Its IUPAC name is 7-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-[(1-methylazocan-5-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]-4,4a,5,6,8,8a-hexahydro-2,7-naphthyridine-1,3-dione.
| Compound Name | 7-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-[(1-methylazocan-5-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]-4,4a,5,6,8,8a-hexahydro-2,7-naphthyridine-1,3-dione |
|---|---|
| PubChem CID | 164534526 |
| Molecular Formula | C34H36F2N6O3 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | 7-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-[(1-methylazocan-5-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]-4,4a,5,6,8,8a-hexahydro-2,7-naphthyridine-1,3-dione |
| SMILES | CN1CCCC(COc2nc(N3CCC4CC(=O)NC(=O)C4C3)c3cnc(-c4cccc5cccc(F)c45)c(F)c3n2)CCC1 |
| InChI | InChI=1S/C34H36F2N6O3/c1-41-13-4-6-20(7-5-14-41)19-45-34-39-31-24(32(40-34)42-15-12-22-16-27(43)38-33(44)25(22)18-42)17-37-30(29(31)36)23-10-2-8-21-9-3-11-26(35)28(21)23/h2-3,8-11,17,20,22,25H,4-7,12-16,18-19H2,1H3,(H,38,43,44) |
| InChIKey | QCCVUZCWAHADDO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|