C33H33F2N7O3 — CID 164534867
9-[8-fluoro-7-[8-(fluoromethyl)naphthalen-1-yl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 164534867) has the molecular formula C33H33F2N7O3 and a molecular weight of 613.67 g/mol. Its IUPAC name is 9-[8-fluoro-7-[8-(fluoromethyl)naphthalen-1-yl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-[8-fluoro-7-[8-(fluoromethyl)naphthalen-1-yl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 164534867 |
| Molecular Formula | C33H33F2N7O3 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 9-[8-fluoro-7-[8-(fluoromethyl)naphthalen-1-yl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCCN(c3nc(OCC45CCCN4CCC5)nc4c(F)c(-c5cccc6cccc(CF)c56)ncc34)C2)N1 |
| InChI | InChI=1S/C33H33F2N7O3/c34-16-21-8-1-6-20-7-2-9-22(24(20)21)26-25(35)27-23(17-36-26)28(41-13-5-12-33(18-41)29(43)39-30(44)40-33)38-31(37-27)45-19-32-10-3-14-42(32)15-4-11-32/h1-2,6-9,17H,3-5,10-16,18-19H2,(H2,39,40,43,44) |
| InChIKey | VQFMUQWJGLJHEW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|