C7H10F5NO — CID 164536665
1-(4,4-difluorooxan-2-yl)-2,2,2-trifluoroethanamine (PubChem CID 164536665) has the molecular formula C7H10F5NO and a molecular weight of 219.15 g/mol. Its IUPAC name is 1-(4,4-difluorooxan-2-yl)-2,2,2-trifluoroethanamine.
| Compound Name | 1-(4,4-difluorooxan-2-yl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 164536665 |
| Molecular Formula | C7H10F5NO |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 1-(4,4-difluorooxan-2-yl)-2,2,2-trifluoroethanamine |
| SMILES | NC(C1CC(F)(F)CCO1)C(F)(F)F |
| InChI | InChI=1S/C7H10F5NO/c8-6(9)1-2-14-4(3-6)5(13)7(10,11)12/h4-5H,1-3,13H2 |
| InChIKey | AVDKJDWWAFAOAB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |