C28H30N6O3 — CID 164537426
2-(4-phenoxyphenyl)-7-[(1S,5R)-8-prop-2-enoyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide (PubChem CID 164537426) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 2-(4-phenoxyphenyl)-7-[(1S,5R)-8-prop-2-enoyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-phenoxyphenyl)-7-[(1S,5R)-8-prop-2-enoyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164537426 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2-(4-phenoxyphenyl)-7-[(1S,5R)-8-prop-2-enoyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide |
| SMILES | C=CC(=O)N1[C@@H]2CC[C@H]1CN(C1CCNc3c1nn(-c1ccc(Oc4ccccc4)cc1)c3C(N)=O)C2 |
| InChI | InChI=1S/C28H30N6O3/c1-2-24(35)33-19-8-9-20(33)17-32(16-19)23-14-15-30-26-25(23)31-34(27(26)28(29)36)18-10-12-22(13-11-18)37-21-6-4-3-5-7-21/h2-7,10-13,19-20,23,30H,1,8-9,14-17H2,(H2,29,36)/t19-,20+,23? |
| InChIKey | BHTBGUBZYYVHRA-DETIRCLXSA-N |
| XLogP | 3.48 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|