C30H28F3N7O7S — CID 164537485
(7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide (PubChem CID 164537485) has the molecular formula C30H28F3N7O7S and a molecular weight of 687.66 g/mol. Its IUPAC name is (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide.
| Compound Name | (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164537485 |
| Molecular Formula | C30H28F3N7O7S |
| Molecular Weight | 687.66 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide |
| SMILES | NC(=O)c1c2c(nn1-c1ccc(Oc3ccc(OC(F)(F)F)cc3)cc1)[C@H](N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC1)CCN2 |
| InChI | InChI=1S/C30H28F3N7O7S/c31-30(32,33)47-22-11-9-21(10-12-22)46-20-7-5-19(6-8-20)39-28(29(34)41)27-26(36-39)24(13-14-35-27)37-15-17-38(18-16-37)48(44,45)25-4-2-1-3-23(25)40(42)43/h1-12,24,35H,13-18H2,(H2,34,41)/t24-/m1/s1 |
| InChIKey | IXKFMAQAXNVPQV-XMMPIXPASA-N |
| XLogP | 4.43 |
| TPSA | 175.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|