C29H36N6O4 — CID 164537630
tert-butyl 4-[3-carbamoyl-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridin-7-yl]-1,4-diazepane-1-carboxylate (PubChem CID 164537630) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is tert-butyl 4-[3-carbamoyl-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridin-7-yl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[3-carbamoyl-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridin-7-yl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 164537630 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | tert-butyl 4-[3-carbamoyl-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridin-7-yl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C2CCNc3c2nn(-c2ccc(Oc4ccccc4)cc2)c3C(N)=O)CC1 |
| InChI | InChI=1S/C29H36N6O4/c1-29(2,3)39-28(37)34-17-7-16-33(18-19-34)23-14-15-31-25-24(23)32-35(26(25)27(30)36)20-10-12-22(13-11-20)38-21-8-5-4-6-9-21/h4-6,8-13,23,31H,7,14-19H2,1-3H3,(H2,30,36) |
| InChIKey | DCEWDYMINVEBGR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |