C28H32F2N6O4 — CID 164537793
tert-butyl 4-[3-carbamoyl-2-[4-(2,4-difluorophenoxy)phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridin-7-yl]piperazine-1-carboxylate (PubChem CID 164537793) has the molecular formula C28H32F2N6O4 and a molecular weight of 554.60 g/mol. Its IUPAC name is tert-butyl 4-[3-carbamoyl-2-[4-(2,4-difluorophenoxy)phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridin-7-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-carbamoyl-2-[4-(2,4-difluorophenoxy)phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridin-7-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 164537793 |
| Molecular Formula | C28H32F2N6O4 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | tert-butyl 4-[3-carbamoyl-2-[4-(2,4-difluorophenoxy)phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridin-7-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CCNc3c2nn(-c2ccc(Oc4ccc(F)cc4F)cc2)c3C(N)=O)CC1 |
| InChI | InChI=1S/C28H32F2N6O4/c1-28(2,3)40-27(38)35-14-12-34(13-15-35)21-10-11-32-24-23(21)33-36(25(24)26(31)37)18-5-7-19(8-6-18)39-22-9-4-17(29)16-20(22)30/h4-9,16,21,32H,10-15H2,1-3H3,(H2,31,37) |
| InChIKey | JHESAEHHGQRNPA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |