C32H34N6O7S — CID 164537712
ethyl (7S)-2-[4-(3-methylphenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate (PubChem CID 164537712) has the molecular formula C32H34N6O7S and a molecular weight of 646.73 g/mol. Its IUPAC name is ethyl (7S)-2-[4-(3-methylphenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate.
| Compound Name | ethyl (7S)-2-[4-(3-methylphenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164537712 |
| Molecular Formula | C32H34N6O7S |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | ethyl (7S)-2-[4-(3-methylphenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c2c(nn1-c1ccc(Oc3cccc(C)c3)cc1)[C@@H](N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC1)CCN2 |
| InChI | InChI=1S/C32H34N6O7S/c1-3-44-32(39)31-30-29(34-37(31)23-11-13-24(14-12-23)45-25-8-6-7-22(2)21-25)27(15-16-33-30)35-17-19-36(20-18-35)46(42,43)28-10-5-4-9-26(28)38(40)41/h4-14,21,27,33H,3,15-20H2,1-2H3/t27-/m0/s1 |
| InChIKey | KGKBIUOMEMYQPO-MHZLTWQESA-N |
| XLogP | 4.92 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|