C27H31N7O3 — CID 164538463
(18E)-N-[3-(dimethylamino)propyl]-5-methyl-8,11-dioxa-4,5,21,22,25-pentazapentacyclo[18.5.2.02,6.012,17.023,27]heptacosa-1(25),2(6),3,12(17),13,15,18,20,23,26-decaene-15-carboxamide (PubChem CID 164538463) has the molecular formula C27H31N7O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is (18E)-N-[3-(dimethylamino)propyl]-5-methyl-8,11-dioxa-4,5,21,22,25-pentazapentacyclo[18.5.2.02,6.012,17.023,27]heptacosa-1(25),2(6),3,12(17),13,15,18,20,23,26-decaene-15-carboxamide.
| Compound Name | (18E)-N-[3-(dimethylamino)propyl]-5-methyl-8,11-dioxa-4,5,21,22,25-pentazapentacyclo[18.5.2.02,6.012,17.023,27]heptacosa-1(25),2(6),3,12(17),13,15,18,20,23,26-decaene-15-carboxamide |
|---|---|
| PubChem CID | 164538463 |
| Molecular Formula | C27H31N7O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (18E)-N-[3-(dimethylamino)propyl]-5-methyl-8,11-dioxa-4,5,21,22,25-pentazapentacyclo[18.5.2.02,6.012,17.023,27]heptacosa-1(25),2(6),3,12(17),13,15,18,20,23,26-decaene-15-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc2c(c1)/C=C/c1n[nH]c3cnc(cc13)-c1cnn(C)c1COCCO2 |
| InChI | InChI=1S/C27H31N7O3/c1-33(2)10-4-9-28-27(35)19-6-8-26-18(13-19)5-7-22-20-14-23(29-16-24(20)32-31-22)21-15-30-34(3)25(21)17-36-11-12-37-26/h5-8,13-16H,4,9-12,17H2,1-3H3,(H,28,35)(H,31,32)/b7-5+ |
| InChIKey | LAJQNEQQPQZZBM-FNORWQNLSA-N |
| XLogP | 3.12 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|