C20H27N7O — CID 164539385
ethane;1-(4-methylphenyl)-3-[1-(7H-purin-8-yl)piperidin-4-yl]urea (PubChem CID 164539385) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is ethane;1-(4-methylphenyl)-3-[1-(7H-purin-8-yl)piperidin-4-yl]urea.
| Compound Name | ethane;1-(4-methylphenyl)-3-[1-(7H-purin-8-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 164539385 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | ethane;1-(4-methylphenyl)-3-[1-(7H-purin-8-yl)piperidin-4-yl]urea |
| SMILES | CC.Cc1ccc(NC(=O)NC2CCN(c3nc4ncncc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C18H21N7O.C2H6/c1-12-2-4-13(5-3-12)21-18(26)22-14-6-8-25(9-7-14)17-23-15-10-19-11-20-16(15)24-17;1-2/h2-5,10-11,14H,6-9H2,1H3,(H2,21,22,26)(H,19,20,23,24);1-2H3 |
| InChIKey | DDKHCMNQQYYTBB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |