C16H20BN4O3 — CID 164542967
CID 164542967 (PubChem CID 164542967) has the molecular formula C16H20BN4O3 and a molecular weight of 327.17 g/mol.
| Compound Name | CID 164542967 |
|---|---|
| PubChem CID | 164542967 |
| Molecular Formula | C16H20BN4O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | — |
| SMILES | NC(=O)c1cn(C2CCCC2)nc1Nc1ccc([B]O)c(CO)c1 |
| InChI | InChI=1S/C16H20BN4O3/c18-15(23)13-8-21(12-3-1-2-4-12)20-16(13)19-11-5-6-14(17-24)10(7-11)9-22/h5-8,12,22,24H,1-4,9H2,(H2,18,23)(H,19,20) |
| InChIKey | IESCCXTYANQCSW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|