C17H21BN4O4 — CID 164542697
3-[(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-6-yl)amino]-1-[(3R)-oxan-3-yl]pyrazole-4-carboxamide (PubChem CID 164542697) has the molecular formula C17H21BN4O4 and a molecular weight of 356.19 g/mol. Its IUPAC name is 3-[(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-6-yl)amino]-1-[(3R)-oxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-[(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-6-yl)amino]-1-[(3R)-oxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164542697 |
| Molecular Formula | C17H21BN4O4 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-[(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-6-yl)amino]-1-[(3R)-oxan-3-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cn([C@@H]2CCCOC2)nc1Nc1ccc2c(c1)CCOB2O |
| InChI | InChI=1S/C17H21BN4O4/c19-16(23)14-9-22(13-2-1-6-25-10-13)21-17(14)20-12-3-4-15-11(8-12)5-7-26-18(15)24/h3-4,8-9,13,24H,1-2,5-7,10H2,(H2,19,23)(H,20,21)/t13-/m1/s1 |
| InChIKey | UQBDDESVWKZHBN-CYBMUJFWSA-N |
| XLogP | 0.34 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|