C16H18BClN4O4 — CID 164542743
3-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-1-(oxan-3-yl)pyrazole-4-carboxamide (PubChem CID 164542743) has the molecular formula C16H18BClN4O4 and a molecular weight of 376.61 g/mol. Its IUPAC name is 3-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-1-(oxan-3-yl)pyrazole-4-carboxamide.
| Compound Name | 3-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-1-(oxan-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164542743 |
| Molecular Formula | C16H18BClN4O4 |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 3-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-1-(oxan-3-yl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cn(C2CCCOC2)nc1Nc1cc(Cl)c2c(c1)COB2O |
| InChI | InChI=1S/C16H18BClN4O4/c18-13-5-10(4-9-7-26-17(24)14(9)13)20-16-12(15(19)23)6-22(21-16)11-2-1-3-25-8-11/h4-6,11,24H,1-3,7-8H2,(H2,19,23)(H,20,21) |
| InChIKey | QOSPOEIAHGFYHY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|