C20H25BN4O4 — CID 164542762
3-[(2-hydroxy-3-propan-2-yl-1,2-benzoxaborinin-6-yl)amino]-1-[(3R)-oxan-3-yl]pyrazole-4-carboxamide (PubChem CID 164542762) has the molecular formula C20H25BN4O4 and a molecular weight of 396.26 g/mol. Its IUPAC name is 3-[(2-hydroxy-3-propan-2-yl-1,2-benzoxaborinin-6-yl)amino]-1-[(3R)-oxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-[(2-hydroxy-3-propan-2-yl-1,2-benzoxaborinin-6-yl)amino]-1-[(3R)-oxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164542762 |
| Molecular Formula | C20H25BN4O4 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-[(2-hydroxy-3-propan-2-yl-1,2-benzoxaborinin-6-yl)amino]-1-[(3R)-oxan-3-yl]pyrazole-4-carboxamide |
| SMILES | CC(C)C1=Cc2cc(Nc3nn([C@@H]4CCCOC4)cc3C(N)=O)ccc2OB1O |
| InChI | InChI=1S/C20H25BN4O4/c1-12(2)17-9-13-8-14(5-6-18(13)29-21(17)27)23-20-16(19(22)26)10-25(24-20)15-4-3-7-28-11-15/h5-6,8-10,12,15,27H,3-4,7,11H2,1-2H3,(H2,22,26)(H,23,24)/t15-/m1/s1 |
| InChIKey | BAQJAIKPNZQOLI-OAHLLOKOSA-N |
| XLogP | 2.53 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|