C10H15N3O3 — CID 175464104
3-(hydroxymethyl)-1-(oxan-3-yl)pyrazole-4-carboxamide (PubChem CID 175464104) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1-(oxan-3-yl)pyrazole-4-carboxamide.
| Compound Name | 3-(hydroxymethyl)-1-(oxan-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 175464104 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-(hydroxymethyl)-1-(oxan-3-yl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cn(C2CCCOC2)nc1CO |
| InChI | InChI=1S/C10H15N3O3/c11-10(15)8-4-13(12-9(8)5-14)7-2-1-3-16-6-7/h4,7,14H,1-3,5-6H2,(H2,11,15) |
| InChIKey | ABBTVGVSRAAAJE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |