C17H20BClN4O3 — CID 170626305
2-N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methyl-4-N-[(3R)-oxan-3-yl]pyrimidine-2,4-diamine (PubChem CID 170626305) has the molecular formula C17H20BClN4O3 and a molecular weight of 374.64 g/mol. Its IUPAC name is 2-N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methyl-4-N-[(3R)-oxan-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methyl-4-N-[(3R)-oxan-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 170626305 |
| Molecular Formula | C17H20BClN4O3 |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methyl-4-N-[(3R)-oxan-3-yl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2cc(Cl)c3c(c2)COB3O)nc1N[C@@H]1CCCOC1 |
| InChI | InChI=1S/C17H20BClN4O3/c1-10-7-20-17(23-16(10)21-12-3-2-4-25-9-12)22-13-5-11-8-26-18(24)15(11)14(19)6-13/h5-7,12,24H,2-4,8-9H2,1H3,(H2,20,21,22,23)/t12-/m1/s1 |
| InChIKey | OMXQVNZMRATDEI-GFCCVEGCSA-N |
| XLogP | 1.99 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|