C19H23BN4O3 — CID 170626286
4-N-cyclopentyl-5-methyl-2-N-(2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-6-yl)pyrimidine-2,4-diamine (PubChem CID 170626286) has the molecular formula C19H23BN4O3 and a molecular weight of 366.23 g/mol. Its IUPAC name is 4-N-cyclopentyl-5-methyl-2-N-(2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-6-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopentyl-5-methyl-2-N-(2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-6-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 170626286 |
| Molecular Formula | C19H23BN4O3 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-N-cyclopentyl-5-methyl-2-N-(2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-6-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2cc3c4c(c2)OCCOB4OC3)nc1NC1CCCC1 |
| InChI | InChI=1S/C19H23BN4O3/c1-12-10-21-19(24-18(12)22-14-4-2-3-5-14)23-15-8-13-11-27-20-17(13)16(9-15)25-6-7-26-20/h8-10,14H,2-7,11H2,1H3,(H2,21,22,23,24) |
| InChIKey | JUEZGNBUKYFKPN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|