C23H30F2N4O2 — CID 164543157
tert-butyl N-[(3R)-1-[[3-amino-5-(6-methyl-3-pyridinyl)phenyl]methyl]-4,4-difluoropiperidin-3-yl]carbamate (PubChem CID 164543157) has the molecular formula C23H30F2N4O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[[3-amino-5-(6-methyl-3-pyridinyl)phenyl]methyl]-4,4-difluoropiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[[3-amino-5-(6-methyl-3-pyridinyl)phenyl]methyl]-4,4-difluoropiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 164543157 |
| Molecular Formula | C23H30F2N4O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | tert-butyl N-[(3R)-1-[[3-amino-5-(6-methyl-3-pyridinyl)phenyl]methyl]-4,4-difluoropiperidin-3-yl]carbamate |
| SMILES | Cc1ccc(-c2cc(N)cc(CN3CCC(F)(F)[C@H](NC(=O)OC(C)(C)C)C3)c2)cn1 |
| InChI | InChI=1S/C23H30F2N4O2/c1-15-5-6-17(12-27-15)18-9-16(10-19(26)11-18)13-29-8-7-23(24,25)20(14-29)28-21(30)31-22(2,3)4/h5-6,9-12,20H,7-8,13-14,26H2,1-4H3,(H,28,30)/t20-/m1/s1 |
| InChIKey | WINCWIWHFWJBFY-HXUWFJFHSA-N |
| XLogP | 4.37 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|