C22H28BrFN4O2 — CID 167136894
tert-butyl N-[(3R,4R)-1-[[2-bromo-6-(6-methyl-3-pyridinyl)-4-pyridinyl]methyl]-4-fluoropiperidin-3-yl]carbamate (PubChem CID 167136894) has the molecular formula C22H28BrFN4O2 and a molecular weight of 479.39 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-1-[[2-bromo-6-(6-methyl-3-pyridinyl)-4-pyridinyl]methyl]-4-fluoropiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-1-[[2-bromo-6-(6-methyl-3-pyridinyl)-4-pyridinyl]methyl]-4-fluoropiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 167136894 |
| Molecular Formula | C22H28BrFN4O2 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | tert-butyl N-[(3R,4R)-1-[[2-bromo-6-(6-methyl-3-pyridinyl)-4-pyridinyl]methyl]-4-fluoropiperidin-3-yl]carbamate |
| SMILES | Cc1ccc(-c2cc(CN3CC[C@@H](F)[C@H](NC(=O)OC(C)(C)C)C3)cc(Br)n2)cn1 |
| InChI | InChI=1S/C22H28BrFN4O2/c1-14-5-6-16(11-25-14)18-9-15(10-20(23)26-18)12-28-8-7-17(24)19(13-28)27-21(29)30-22(2,3)4/h5-6,9-11,17,19H,7-8,12-13H2,1-4H3,(H,27,29)/t17-,19-/m1/s1 |
| InChIKey | WWTRLFPLCKNDFK-IEBWSBKVSA-N |
| XLogP | 4.65 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|