C22H29BrFN4O2P — CID 164543337
tert-butyl N-[(3R)-1-[[2-bromo-6-(6-methyl-3-pyridinyl)-4-pyridinyl]methyl]-4-fluoro-4-phosphanylpiperidin-3-yl]carbamate (PubChem CID 164543337) has the molecular formula C22H29BrFN4O2P and a molecular weight of 511.38 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[[2-bromo-6-(6-methyl-3-pyridinyl)-4-pyridinyl]methyl]-4-fluoro-4-phosphanylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[[2-bromo-6-(6-methyl-3-pyridinyl)-4-pyridinyl]methyl]-4-fluoro-4-phosphanylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 164543337 |
| Molecular Formula | C22H29BrFN4O2P |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | tert-butyl N-[(3R)-1-[[2-bromo-6-(6-methyl-3-pyridinyl)-4-pyridinyl]methyl]-4-fluoro-4-phosphanylpiperidin-3-yl]carbamate |
| SMILES | Cc1ccc(-c2cc(CN3CCC(F)(P)[C@H](NC(=O)OC(C)(C)C)C3)cc(Br)n2)cn1 |
| InChI | InChI=1S/C22H29BrFN4O2P/c1-14-5-6-16(11-25-14)17-9-15(10-19(23)26-17)12-28-8-7-22(24,31)18(13-28)27-20(29)30-21(2,3)4/h5-6,9-11,18H,7-8,12-13,31H2,1-4H3,(H,27,29)/t18-,22?/m1/s1 |
| InChIKey | NKDBJDQFKUDJIR-ZZWBGTBQSA-N |
| XLogP | 4.85 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|