C15H29BN2O3 — CID 164549432
CID 164549432 (PubChem CID 164549432) has the molecular formula C15H29BN2O3 and a molecular weight of 296.22 g/mol.
| Compound Name | CID 164549432 |
|---|---|
| PubChem CID | 164549432 |
| Molecular Formula | C15H29BN2O3 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | — |
| SMILES | CC(C)C(N)C(=O)NCC1CCCCC1C(=O)O.[B]CC |
| InChI | InChI=1S/C13H24N2O3.C2H5B/c1-8(2)11(14)12(16)15-7-9-5-3-4-6-10(9)13(17)18;1-2-3/h8-11H,3-7,14H2,1-2H3,(H,15,16)(H,17,18);2H2,1H3 |
| InChIKey | UMQFHLVGOWRQEV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|