C14H27N5O3 — CID 164549554
2-[[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 164549554) has the molecular formula C14H27N5O3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164549554 |
| Molecular Formula | C14H27N5O3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 2-[[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NCC1CCCCC1C(=O)O |
| InChI | InChI=1S/C14H27N5O3/c15-11(6-3-7-18-14(16)17)12(20)19-8-9-4-1-2-5-10(9)13(21)22/h9-11H,1-8,15H2,(H,19,20)(H,21,22)(H4,16,17,18) |
| InChIKey | RWSKJNUYVXCWQN-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|