C21H35BN2O4 — CID 164549514
CID 164549514 (PubChem CID 164549514) has the molecular formula C21H35BN2O4 and a molecular weight of 390.33 g/mol.
| Compound Name | CID 164549514 |
|---|---|
| PubChem CID | 164549514 |
| Molecular Formula | C21H35BN2O4 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | — |
| SMILES | CC.NC(Cc1ccc(O)cc1)C(=O)NCC1CCCCC1C(=O)O.[B]CC |
| InChI | InChI=1S/C17H24N2O4.C2H5B.C2H6/c18-15(9-11-5-7-13(20)8-6-11)16(21)19-10-12-3-1-2-4-14(12)17(22)23;1-2-3;1-2/h5-8,12,14-15,20H,1-4,9-10,18H2,(H,19,21)(H,22,23);2H2,1H3;1-2H3 |
| InChIKey | IPQFPJQPUUIAKS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|