C15H15ClF2N2O3 — CID 164549684
1-[2-(2-chloro-3,5-difluorophenoxy)ethyl]-5-propan-2-ylpyrazole-4-carboxylic acid (PubChem CID 164549684) has the molecular formula C15H15ClF2N2O3 and a molecular weight of 344.75 g/mol. Its IUPAC name is 1-[2-(2-chloro-3,5-difluorophenoxy)ethyl]-5-propan-2-ylpyrazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-chloro-3,5-difluorophenoxy)ethyl]-5-propan-2-ylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 164549684 |
| Molecular Formula | C15H15ClF2N2O3 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[2-(2-chloro-3,5-difluorophenoxy)ethyl]-5-propan-2-ylpyrazole-4-carboxylic acid |
| SMILES | CC(C)c1c(C(=O)O)cnn1CCOc1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C15H15ClF2N2O3/c1-8(2)14-10(15(21)22)7-19-20(14)3-4-23-12-6-9(17)5-11(18)13(12)16/h5-8H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | VLOUCUWSPGIDMR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|