C9H7ClF2O3 — CID 164905285
methyl 2-(2-chloro-3,5-difluorophenoxy)acetate (PubChem CID 164905285) has the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. Its IUPAC name is methyl 2-(2-chloro-3,5-difluorophenoxy)acetate.
| Compound Name | methyl 2-(2-chloro-3,5-difluorophenoxy)acetate |
|---|---|
| PubChem CID | 164905285 |
| Molecular Formula | C9H7ClF2O3 |
| Molecular Weight | 236.60 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | methyl 2-(2-chloro-3,5-difluorophenoxy)acetate |
| SMILES | COC(=O)COc1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C9H7ClF2O3/c1-14-8(13)4-15-7-3-5(11)2-6(12)9(7)10/h2-3H,4H2,1H3 |
| InChIKey | CFGIFRDYCVZTGN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|