C23H25ClN4OS — CID 164550365
6-(butylamino)-3-(4-chlorophenyl)-1-ethyl-5-phenylimidazo[4,5-c]thiazin-4-one (PubChem CID 164550365) has the molecular formula C23H25ClN4OS and a molecular weight of 441.00 g/mol. Its IUPAC name is 6-(butylamino)-3-(4-chlorophenyl)-1-ethyl-5-phenylimidazo[4,5-c]thiazin-4-one.
| Compound Name | 6-(butylamino)-3-(4-chlorophenyl)-1-ethyl-5-phenylimidazo[4,5-c]thiazin-4-one |
|---|---|
| PubChem CID | 164550365 |
| Molecular Formula | C23H25ClN4OS |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 6-(butylamino)-3-(4-chlorophenyl)-1-ethyl-5-phenylimidazo[4,5-c]thiazin-4-one |
| SMILES | CCCCNc1nc2c(n1-c1ccccc1)C(=O)C(c1ccc(Cl)cc1)SN2CC |
| InChI | InChI=1S/C23H25ClN4OS/c1-3-5-15-25-23-26-22-19(28(23)18-9-7-6-8-10-18)20(29)21(30-27(22)4-2)16-11-13-17(24)14-12-16/h6-14,21H,3-5,15H2,1-2H3,(H,25,26) |
| InChIKey | LSTRUNFZNZWGRC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|