C29H48O — CID 164550770
(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-5-propan-2-ylhepta-4,6-dien-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol (PubChem CID 164550770) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-5-propan-2-ylhepta-4,6-dien-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol.
| Compound Name | (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-5-propan-2-ylhepta-4,6-dien-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol |
|---|---|
| PubChem CID | 164550770 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-5-propan-2-ylhepta-4,6-dien-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol |
| SMILES | C=CC(=CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4(O)CCCC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C29H48O/c1-7-22(20(2)3)11-10-21(4)24-12-13-25-23-14-19-29(30)17-9-8-16-28(29,6)26(23)15-18-27(24,25)5/h7,11,20-21,23-26,30H,1,8-10,12-19H2,2-6H3/t21-,23+,24-,25+,26+,27-,28-,29?/m1/s1 |
| InChIKey | RIVFEOLTFROSFY-HYHTUSMQSA-N |
| XLogP | 7.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|