C25H42O2 — CID 143398918
(4R)-4-[(5S,10R,13R)-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 143398918) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (4R)-4-[(5S,10R,13R)-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(5S,10R,13R)-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 143398918 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (4R)-4-[(5S,10R,13R)-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)C1CCC2C3CC[C@]4(C)CCCC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H42O2/c1-17(7-10-22(26)27)19-8-9-20-18-11-15-23(2)13-5-6-14-25(23,4)21(18)12-16-24(19,20)3/h17-21H,5-16H2,1-4H3,(H,26,27)/t17-,18?,19?,20?,21?,23+,24-,25-/m1/s1 |
| InChIKey | ZQDMVWPNNIROPY-XGYVNGACSA-N |
| XLogP | 6.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |