C25H43NO3 — CID 144728616
(4R)-4-(5-amino-3-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid (PubChem CID 144728616) has the molecular formula C25H43NO3 and a molecular weight of 405.62 g/mol. Its IUPAC name is (4R)-4-(5-amino-3-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid.
| Compound Name | (4R)-4-(5-amino-3-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid |
|---|---|
| PubChem CID | 144728616 |
| Molecular Formula | C25H43NO3 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | (4R)-4-(5-amino-3-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid |
| SMILES | COC1CCC2(C)C3CCC4(C)C(CCC4[C@H](C)CCC(=O)O)C3CCC2(N)C1 |
| InChI | InChI=1S/C25H43NO3/c1-16(5-8-22(27)28)19-6-7-20-18-10-14-25(26)15-17(29-4)9-13-24(25,3)21(18)11-12-23(19,20)2/h16-21H,5-15,26H2,1-4H3,(H,27,28)/t16-,17?,18?,19?,20?,21?,23?,24?,25?/m1/s1 |
| InChIKey | UZEKTOHGPYWXHF-WRAFIJKQSA-N |
| XLogP | 5.24 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |