C28H50N4O2 — CID 163886815
4-[(5R,10R,13R,17R)-5-amino-3-[(ethylaminomethylamino)methyl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-N-oxopentanamide (PubChem CID 163886815) has the molecular formula C28H50N4O2 and a molecular weight of 474.73 g/mol. Its IUPAC name is 4-[(5R,10R,13R,17R)-5-amino-3-[(ethylaminomethylamino)methyl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-N-oxopentanamide.
| Compound Name | 4-[(5R,10R,13R,17R)-5-amino-3-[(ethylaminomethylamino)methyl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-N-oxopentanamide |
|---|---|
| PubChem CID | 163886815 |
| Molecular Formula | C28H50N4O2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | 4-[(5R,10R,13R,17R)-5-amino-3-[(ethylaminomethylamino)methyl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-N-oxopentanamide |
| SMILES | CCNCNCC1CC[C@]2(C)C3CC[C@@]4(C)C(CC[C@@H]4C(C)CCC(=O)N=O)C3CC[C@@]2(N)C1 |
| InChI | InChI=1S/C28H50N4O2/c1-5-30-18-31-17-20-10-14-27(4)24-12-13-26(3)22(19(2)6-9-25(33)32-34)7-8-23(26)21(24)11-15-28(27,29)16-20/h19-24,30-31H,5-18,29H2,1-4H3/t19?,20?,21?,22-,23?,24?,26-,27-,28-/m1/s1 |
| InChIKey | PYBLDBALTKMYKO-IQTNGYPKSA-N |
| XLogP | 5.21 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|