C36H70O4Si3 — CID 91747844
[ethyl(dimethyl)silyl] 4-[(3R,5S)-3,5-bis[[ethyl(dimethyl)silyl]oxy]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 91747844) has the molecular formula C36H70O4Si3 and a molecular weight of 651.21 g/mol. Its IUPAC name is [ethyl(dimethyl)silyl] 4-[(3R,5S)-3,5-bis[[ethyl(dimethyl)silyl]oxy]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | [ethyl(dimethyl)silyl] 4-[(3R,5S)-3,5-bis[[ethyl(dimethyl)silyl]oxy]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 91747844 |
| Molecular Formula | C36H70O4Si3 |
| Molecular Weight | 651.21 g/mol |
| Exact Mass | 650.46 |
| IUPAC Name | [ethyl(dimethyl)silyl] 4-[(3R,5S)-3,5-bis[[ethyl(dimethyl)silyl]oxy]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CC[Si](C)(C)OC(=O)CCC(C)C1CCC2C3CC[C@]4(O[Si](C)(C)CC)C[C@H](O[Si](C)(C)CC)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C36H70O4Si3/c1-13-41(7,8)38-28-20-24-35(6)32-22-23-34(5)30(27(4)16-19-33(37)39-42(9,10)14-2)17-18-31(34)29(32)21-25-36(35,26-28)40-43(11,12)15-3/h27-32H,13-26H2,1-12H3/t27?,28-,29?,30?,31?,32?,34?,35?,36+/m1/s1 |
| InChIKey | GUNUQSBFHLXXIW-BQTKKRLYSA-N |
| XLogP | 10.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.21 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|