C46H93NO4 — CID 164551929
heptadecan-9-yl 8-[2-hydroxyethyl(5-prop-1-en-2-yloxypentyl)amino]octanoate;2-methyldecane (PubChem CID 164551929) has the molecular formula C46H93NO4 and a molecular weight of 724.25 g/mol. Its IUPAC name is heptadecan-9-yl 8-[2-hydroxyethyl(5-prop-1-en-2-yloxypentyl)amino]octanoate;2-methyldecane.
| Compound Name | heptadecan-9-yl 8-[2-hydroxyethyl(5-prop-1-en-2-yloxypentyl)amino]octanoate;2-methyldecane |
|---|---|
| PubChem CID | 164551929 |
| Molecular Formula | C46H93NO4 |
| Molecular Weight | 724.25 g/mol |
| Exact Mass | 723.71 |
| IUPAC Name | heptadecan-9-yl 8-[2-hydroxyethyl(5-prop-1-en-2-yloxypentyl)amino]octanoate;2-methyldecane |
| SMILES | C=C(C)OCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC.CCCCCCCCC(C)C |
| InChI | InChI=1S/C35H69NO4.C11H24/c1-5-7-9-11-14-19-25-34(26-20-15-12-10-8-6-2)40-35(38)27-21-16-13-17-22-28-36(30-31-37)29-23-18-24-32-39-33(3)4;1-4-5-6-7-8-9-10-11(2)3/h34,37H,3,5-32H2,1-2,4H3;11H,4-10H2,1-3H3 |
| InChIKey | BONSOVBZDKDFOF-UHFFFAOYSA-N |
| XLogP | 14.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.25 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|