About ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine
ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine (PubChem CID 164552181) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine.
Molecular Properties
| Compound Name | ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine |
| PubChem CID | 164552181 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine |
| SMILES | CC.[H]/N=C1C(=C/C)\C=CN\1C(CC)CCC |
| InChI | InChI=1S/C12H20N2.C2H6/c1-4-7-11(6-3)14-9-8-10(5-2)12(14)13;1-2/h5,8-9,11,13H,4,6-7H2,1-3H3;1-2H3/b10-5-,13-12+; |
| InChIKey | INEAYIPUEURZCW-WONNPFSBSA-N |
| XLogP | 4.34 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine?
The IUPAC name of ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine (CID 164552181) is ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine.
What is the SMILES notation for ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine?
The canonical SMILES for ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine is CC.[H]/N=C1C(=C/C)\C=CN\1C(CC)CCC.
What is the InChIKey of ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine?
The InChIKey is INEAYIPUEURZCW-WONNPFSBSA-N. The full InChI is InChI=1S/C12H20N2.C2H6/c1-4-7-11(6-3)14-9-8-10(5-2)12(14)13;1-2/h5,8-9,11,13H,4,6-7H2,1-3H3;1-2H3/b10-5-,13-12+;.
What are the key properties of ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine?
ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine has a molecular weight of 222.38 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-3-ethylidene-1-hexan-3-ylpyrrol-2-imine is sourced from PubChem (CID 164552181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).