C12H18FN3 — CID 178081162
(3Z)-3-ethylidene-1-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrrol-2-imine (PubChem CID 178081162) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is (3Z)-3-ethylidene-1-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrrol-2-imine.
| Compound Name | (3Z)-3-ethylidene-1-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrrol-2-imine |
|---|---|
| PubChem CID | 178081162 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | (3Z)-3-ethylidene-1-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrrol-2-imine |
| SMILES | [H]/N=C1C(=C/C)\C=CN\1[C@H]1CCN(C)C[C@@H]1F |
| InChI | InChI=1S/C12H18FN3/c1-3-9-4-7-16(12(9)14)11-5-6-15(2)8-10(11)13/h3-4,7,10-11,14H,5-6,8H2,1-2H3/b9-3-,14-12+/t10-,11-/m0/s1 |
| InChIKey | OOHDWXGVSHFYPT-ZCSYEPJNSA-N |
| XLogP | 1.78 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|