C15H23FN2 — CID 142082960
(2E,3Z,5E)-2-ethylidene-6-fluoro-5-methyl-1-piperidin-1-ylhepta-3,5-dien-1-imine (PubChem CID 142082960) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is (2E,3Z,5E)-2-ethylidene-6-fluoro-5-methyl-1-piperidin-1-ylhepta-3,5-dien-1-imine.
| Compound Name | (2E,3Z,5E)-2-ethylidene-6-fluoro-5-methyl-1-piperidin-1-ylhepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 142082960 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (2E,3Z,5E)-2-ethylidene-6-fluoro-5-methyl-1-piperidin-1-ylhepta-3,5-dien-1-imine |
| SMILES | [H]/N=C(C(/C=C\C(C)=C(/C)F)=C/C)\N1CCCCC1 |
| InChI | InChI=1S/C15H23FN2/c1-4-14(9-8-12(2)13(3)16)15(17)18-10-6-5-7-11-18/h4,8-9,17H,5-7,10-11H2,1-3H3/b9-8-,13-12+,14-4+,17-15- |
| InChIKey | KRRFTELEEPJTCY-HVURYOQYSA-N |
| XLogP | 4.22 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|