C23H21F3N6 — CID 164553910
3-methyl-6-(6-piperazin-1-yl-3-pyridinyl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]-1H-indole (PubChem CID 164553910) has the molecular formula C23H21F3N6 and a molecular weight of 438.46 g/mol. Its IUPAC name is 3-methyl-6-(6-piperazin-1-yl-3-pyridinyl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]-1H-indole.
| Compound Name | 3-methyl-6-(6-piperazin-1-yl-3-pyridinyl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]-1H-indole |
|---|---|
| PubChem CID | 164553910 |
| Molecular Formula | C23H21F3N6 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 3-methyl-6-(6-piperazin-1-yl-3-pyridinyl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]-1H-indole |
| SMILES | Cc1c(-c2cnc(C(F)(F)F)nc2)[nH]c2cc(-c3ccc(N4CCNCC4)nc3)ccc12 |
| InChI | InChI=1S/C23H21F3N6/c1-14-18-4-2-15(16-3-5-20(28-11-16)32-8-6-27-7-9-32)10-19(18)31-21(14)17-12-29-22(30-13-17)23(24,25)26/h2-5,10-13,27,31H,6-9H2,1H3 |
| InChIKey | GUSWMHMURGDFMT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |