About 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine
4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine (PubChem CID 164554506) has the molecular formula C20H26N4O
and a molecular weight of 338.46 g/mol. Its IUPAC name is 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine.
Molecular Properties
| Compound Name | 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine |
| PubChem CID | 164554506 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine |
| SMILES | C=O.CCCCc1ccc(N)cc1.Nc1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C10H15N.C9H9N3.CH2O/c1-2-3-4-9-5-7-10(11)8-6-9;10-8-6-11-12-9(8)7-4-2-1-3-5-7;1-2/h5-8H,2-4,11H2,1H3;1-6H,10H2,(H,11,12);1H2 |
| InChIKey | KMQSXUNLFFKOFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine?
The IUPAC name of 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine (CID 164554506) is 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine.
What is the SMILES notation for 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine?
The canonical SMILES for 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine is C=O.CCCCc1ccc(N)cc1.Nc1cn[nH]c1-c1ccccc1.
What is the InChIKey of 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine?
The InChIKey is KMQSXUNLFFKOFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C9H9N3.CH2O/c1-2-3-4-9-5-7-10(11)8-6-9;10-8-6-11-12-9(8)7-4-2-1-3-5-7;1-2/h5-8H,2-4,11H2,1H3;1-6H,10H2,(H,11,12);1H2.
What are the key properties of 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine?
4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine has a molecular weight of 338.46 g/mol, XLogP of 4.09, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylaniline;formaldehyde;5-phenyl-1H-pyrazol-4-amine is sourced from PubChem (CID 164554506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).