molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine

C8H22N2 — CID 164555639

IUPACmolecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine
SMILESCC(C)N[C@H]1CCCNC1.[H][H].[H][H]
InChIInChI=1S/C8H18N2.2H2/c1-7(2)10-8-4-3-5-9-6-8;;/h7-10H,3-6H2,1-2H3;2*1H/t8-;;/m0../s1
InChIKeyPEVBTAJOOOIDKM-JZGIKJSDSA-N
MW146.28 g/mol
LogP1.23
Rot. Bonds2

About molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine

molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine (PubChem CID 164555639) has the molecular formula C8H22N2 and a molecular weight of 146.28 g/mol. Its IUPAC name is molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine.

Molecular Properties

Compound Namemolecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine
PubChem CID164555639
Molecular FormulaC8H22N2
Molecular Weight146.28 g/mol
Exact Mass146.18
IUPAC Namemolecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine
SMILESCC(C)N[C@H]1CCCNC1.[H][H].[H][H]
InChIInChI=1S/C8H18N2.2H2/c1-7(2)10-8-4-3-5-9-6-8;;/h7-10H,3-6H2,1-2H3;2*1H/t8-;;/m0../s1
InChIKeyPEVBTAJOOOIDKM-JZGIKJSDSA-N
XLogP1.23
TPSA24.06 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.28
LogP ≤ 51.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine?
The IUPAC name of molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine (CID 164555639) is molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine.
What is the SMILES notation for molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine?
The canonical SMILES for molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine is CC(C)N[C@H]1CCCNC1.[H][H].[H][H].
What is the InChIKey of molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine?
The InChIKey is PEVBTAJOOOIDKM-JZGIKJSDSA-N. The full InChI is InChI=1S/C8H18N2.2H2/c1-7(2)10-8-4-3-5-9-6-8;;/h7-10H,3-6H2,1-2H3;2*1H/t8-;;/m0../s1.
What are the key properties of molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine?
molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine has a molecular weight of 146.28 g/mol, XLogP of 1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine is sourced from PubChem (CID 164555639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).