About molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine
molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine (PubChem CID 164555639) has the molecular formula C8H22N2
and a molecular weight of 146.28 g/mol. Its IUPAC name is molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine.
Molecular Properties
| Compound Name | molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine |
| PubChem CID | 164555639 |
| Molecular Formula | C8H22N2 |
| Molecular Weight | 146.28 g/mol |
| Exact Mass | 146.18 |
| IUPAC Name | molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine |
| SMILES | CC(C)N[C@H]1CCCNC1.[H][H].[H][H] |
| InChI | InChI=1S/C8H18N2.2H2/c1-7(2)10-8-4-3-5-9-6-8;;/h7-10H,3-6H2,1-2H3;2*1H/t8-;;/m0../s1 |
| InChIKey | PEVBTAJOOOIDKM-JZGIKJSDSA-N |
| XLogP | 1.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine?
The IUPAC name of molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine (CID 164555639) is molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine.
What is the SMILES notation for molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine?
The canonical SMILES for molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine is CC(C)N[C@H]1CCCNC1.[H][H].[H][H].
What is the InChIKey of molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine?
The InChIKey is PEVBTAJOOOIDKM-JZGIKJSDSA-N. The full InChI is InChI=1S/C8H18N2.2H2/c1-7(2)10-8-4-3-5-9-6-8;;/h7-10H,3-6H2,1-2H3;2*1H/t8-;;/m0../s1.
What are the key properties of molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine?
molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine has a molecular weight of 146.28 g/mol, XLogP of 1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;(3S)-N-propan-2-ylpiperidin-3-amine is sourced from PubChem (CID 164555639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).